C27H36O5S — CID 15617517
(2S,3S)-3-(2-carboxyethylsulfanyl)-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid (PubChem CID 15617517) has the molecular formula C27H36O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is (2S,3S)-3-(2-carboxyethylsulfanyl)-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid.
| Compound Name | (2S,3S)-3-(2-carboxyethylsulfanyl)-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 15617517 |
| Molecular Formula | C27H36O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (2S,3S)-3-(2-carboxyethylsulfanyl)-2-methoxy-3-[2-(8-phenyloctyl)phenyl]propanoic acid |
| SMILES | CO[C@@H](C(=O)O)[C@@H](SCCC(=O)O)c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C27H36O5S/c1-32-25(27(30)31)26(33-20-19-24(28)29)23-18-12-11-17-22(23)16-10-5-3-2-4-7-13-21-14-8-6-9-15-21/h6,8-9,11-12,14-15,17-18,25-26H,2-5,7,10,13,16,19-20H2,1H3,(H,28,29)(H,30,31)/t25-,26+/m1/s1 |
| InChIKey | WZBAZYNNDZXZAX-FTJBHMTQSA-N |
| XLogP | 6.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|