About N'-benzoyl-N'-butylbenzohydrazide
N'-benzoyl-N'-butylbenzohydrazide (PubChem CID 15617820) has the molecular formula C18H20N2O2
and a molecular weight of 296.37 g/mol. Its IUPAC name is N'-benzoyl-N'-butylbenzohydrazide.
Molecular Properties
| Compound Name | N'-benzoyl-N'-butylbenzohydrazide |
| PubChem CID | 15617820 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-benzoyl-N'-butylbenzohydrazide |
| SMILES | CCCCN(NC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-2-3-14-20(18(22)16-12-8-5-9-13-16)19-17(21)15-10-6-4-7-11-15/h4-13H,2-3,14H2,1H3,(H,19,21) |
| InChIKey | JPCINQVIGWHSIZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzoyl-N'-butylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzoyl-N'-butylbenzohydrazide?
The IUPAC name of N'-benzoyl-N'-butylbenzohydrazide (CID 15617820) is N'-benzoyl-N'-butylbenzohydrazide.
What is the SMILES notation for N'-benzoyl-N'-butylbenzohydrazide?
The canonical SMILES for N'-benzoyl-N'-butylbenzohydrazide is CCCCN(NC(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of N'-benzoyl-N'-butylbenzohydrazide?
The InChIKey is JPCINQVIGWHSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2/c1-2-3-14-20(18(22)16-12-8-5-9-13-16)19-17(21)15-10-6-4-7-11-15/h4-13H,2-3,14H2,1H3,(H,19,21).
What are the key properties of N'-benzoyl-N'-butylbenzohydrazide?
N'-benzoyl-N'-butylbenzohydrazide has a molecular weight of 296.37 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzoyl-N'-butylbenzohydrazide is sourced from PubChem (CID 15617820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).