About CID 15617982
CID 15617982 (PubChem CID 15617982) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol.
Molecular Properties
| Compound Name | CID 15617982 |
| PubChem CID | 15617982 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | — |
| SMILES | C1COC2(CC3CC4(CC3C2)OCCO4)O1 |
| InChI | InChI=1S/C12H18O4/c1-2-14-11(13-1)5-9-7-12(8-10(9)6-11)15-3-4-16-12/h9-10H,1-8H2 |
| InChIKey | AKQNXCMYIIEGCR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 15617982 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15617982?
The IUPAC name of CID 15617982 (CID 15617982) is not available.
What is the SMILES notation for CID 15617982?
The canonical SMILES for CID 15617982 is C1COC2(CC3CC4(CC3C2)OCCO4)O1.
What is the InChIKey of CID 15617982?
The InChIKey is AKQNXCMYIIEGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-14-11(13-1)5-9-7-12(8-10(9)6-11)15-3-4-16-12/h9-10H,1-8H2.
What are the key properties of CID 15617982?
CID 15617982 has a molecular weight of 226.27 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15617982 is sourced from PubChem (CID 15617982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).