C30H48N2O6 — CID 15618118
[(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 5-(4-methylpiperazin-1-yl)pentanoate (PubChem CID 15618118) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 5-(4-methylpiperazin-1-yl)pentanoate.
| Compound Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 5-(4-methylpiperazin-1-yl)pentanoate |
|---|---|
| PubChem CID | 15618118 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | [(3R,4aR,5S,10S,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,8,9,10-tetrahydro-2H-benzo[f]chromen-5-yl] 5-(4-methylpiperazin-1-yl)pentanoate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]2(O)[C@](C)(O1)[C@@H](OC(=O)CCCCN1CCN(C)CC1)C=C1C(C)(C)CC[C@H](O)[C@@]12C |
| InChI | InChI=1S/C30H48N2O6/c1-8-27(4)20-23(34)30(36)28(5)21(26(2,3)13-12-22(28)33)19-24(29(30,6)38-27)37-25(35)11-9-10-14-32-17-15-31(7)16-18-32/h8,19,22,24,33,36H,1,9-18,20H2,2-7H3/t22-,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | ZITQDZGWTPVNII-NTUQRXMFSA-N |
| XLogP | 2.87 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|