C12H17FN2 — CID 156184118
(1E,3E)-4-fluoro-N-[(Z)-4-methyliminopent-2-en-2-yl]hexa-1,3,5-trien-1-amine (PubChem CID 156184118) has the molecular formula C12H17FN2 and a molecular weight of 208.27 g/mol. Its IUPAC name is (1E,3E)-4-fluoro-N-[(Z)-4-methyliminopent-2-en-2-yl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-4-fluoro-N-[(Z)-4-methyliminopent-2-en-2-yl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 156184118 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (1E,3E)-4-fluoro-N-[(Z)-4-methyliminopent-2-en-2-yl]hexa-1,3,5-trien-1-amine |
| SMILES | C/C(=C/C(=NC)C)/N/C=C/C=C(\C=C)/F |
| InChI | InChI=1S/C12H17FN2/c1-5-12(13)7-6-8-15-11(3)9-10(2)14-4/h5-9,15H,1H2,2-4H3/b8-6+,11-9-,12-7+,14-10? |
| InChIKey | NNLKVQWZBASCBY-GFDZTJOCSA-N |
| XLogP | 2.40 |
| TPSA | 24.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 323 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|