About 6-methoxypteridine-2,4-diamine
6-methoxypteridine-2,4-diamine (PubChem CID 15618942) has the molecular formula C7H8N6O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 6-methoxypteridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-methoxypteridine-2,4-diamine |
| PubChem CID | 15618942 |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 6-methoxypteridine-2,4-diamine |
| SMILES | COc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C7H8N6O/c1-14-3-2-10-6-4(11-3)5(8)12-7(9)13-6/h2H,1H3,(H4,8,9,10,12,13) |
| InChIKey | FELFEWTYNCUHLG-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-methoxypteridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxypteridine-2,4-diamine?
The IUPAC name of 6-methoxypteridine-2,4-diamine (CID 15618942) is 6-methoxypteridine-2,4-diamine.
What is the SMILES notation for 6-methoxypteridine-2,4-diamine?
The canonical SMILES for 6-methoxypteridine-2,4-diamine is COc1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of 6-methoxypteridine-2,4-diamine?
The InChIKey is FELFEWTYNCUHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6O/c1-14-3-2-10-6-4(11-3)5(8)12-7(9)13-6/h2H,1H3,(H4,8,9,10,12,13).
What are the key properties of 6-methoxypteridine-2,4-diamine?
6-methoxypteridine-2,4-diamine has a molecular weight of 192.18 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxypteridine-2,4-diamine is sourced from PubChem (CID 15618942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).