C10H11NO — CID 15619834
(4S)-2-methyl-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 15619834) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (4S)-2-methyl-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-methyl-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15619834 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (4S)-2-methyl-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C10H11NO/c1-8-11-10(7-12-8)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3/t10-/m1/s1 |
| InChIKey | OADZSDHBFLIAPX-SNVBAGLBSA-N |
| XLogP | 2.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |