About [(1R,2R)-2-aminocyclohexyl] acetate
[(1R,2R)-2-aminocyclohexyl] acetate (PubChem CID 15619845) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is [(1R,2R)-2-aminocyclohexyl] acetate.
Molecular Properties
| Compound Name | [(1R,2R)-2-aminocyclohexyl] acetate |
| PubChem CID | 15619845 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(1R,2R)-2-aminocyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C8H15NO2/c1-6(10)11-8-5-3-2-4-7(8)9/h7-8H,2-5,9H2,1H3/t7-,8-/m1/s1 |
| InChIKey | NZWMVSIGTQJHHS-HTQZYQBOSA-N |
| XLogP | 0.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2R)-2-aminocyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-aminocyclohexyl] acetate?
The IUPAC name of [(1R,2R)-2-aminocyclohexyl] acetate (CID 15619845) is [(1R,2R)-2-aminocyclohexyl] acetate.
What is the SMILES notation for [(1R,2R)-2-aminocyclohexyl] acetate?
The canonical SMILES for [(1R,2R)-2-aminocyclohexyl] acetate is CC(=O)O[C@@H]1CCCC[C@H]1N.
What is the InChIKey of [(1R,2R)-2-aminocyclohexyl] acetate?
The InChIKey is NZWMVSIGTQJHHS-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(10)11-8-5-3-2-4-7(8)9/h7-8H,2-5,9H2,1H3/t7-,8-/m1/s1.
What are the key properties of [(1R,2R)-2-aminocyclohexyl] acetate?
[(1R,2R)-2-aminocyclohexyl] acetate has a molecular weight of 157.21 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-aminocyclohexyl] acetate is sourced from PubChem (CID 15619845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).