C9H17NO — CID 15619866
1,3,3,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)(115N)azinan-4-one (PubChem CID 15619866) has the molecular formula C9H17NO and a molecular weight of 173.34 g/mol. Its IUPAC name is 1,3,3,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)(115N)azinan-4-one.
| Compound Name | 1,3,3,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)(115N)azinan-4-one |
|---|---|
| PubChem CID | 15619866 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.23 |
| IUPAC Name | 1,3,3,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)(115N)azinan-4-one |
| SMILES | [2H][15N]1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)C([2H])([2H])C1(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H17NO/c1-8(2)5-7(11)6-9(3,4)10-8/h10H,5-6H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,10+1/hD |
| InChIKey | JWUXJYZVKZKLTJ-AWFCJHQLSA-N |
| XLogP | 1.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |