C8H10O2 — CID 15620109
3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 15620109) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | 3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 15620109 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1OCC2C=CCCC12 |
| InChI | InChI=1S/C8H10O2/c9-8-7-4-2-1-3-6(7)5-10-8/h1,3,6-7H,2,4-5H2 |
| InChIKey | GEWKOBVSQGLPLX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|