About 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline
5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline (PubChem CID 15620519) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| PubChem CID | 15620519 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| SMILES | c1ccc(C2=Nc3ccccc3C3=NCCN23)cc1 |
| InChI | InChI=1S/C16H13N3/c1-2-6-12(7-3-1)15-18-14-9-5-4-8-13(14)16-17-10-11-19(15)16/h1-9H,10-11H2 |
| InChIKey | VXZMEEWZMYYOMZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The IUPAC name of 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline (CID 15620519) is 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline.
What is the SMILES notation for 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The canonical SMILES for 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline is c1ccc(C2=Nc3ccccc3C3=NCCN23)cc1.
What is the InChIKey of 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The InChIKey is VXZMEEWZMYYOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1-2-6-12(7-3-1)15-18-14-9-5-4-8-13(14)16-17-10-11-19(15)16/h1-9H,10-11H2.
What are the key properties of 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline?
5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline has a molecular weight of 247.30 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2,3-dihydroimidazo[1,2-c]quinazoline is sourced from PubChem (CID 15620519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).