About 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione
1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione (PubChem CID 15620660) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione |
| PubChem CID | 15620660 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione |
| SMILES | C=CCN1C(=O)N(CC=C)C1=O |
| InChI | InChI=1S/C8H10N2O2/c1-3-5-9-7(11)10(6-4-2)8(9)12/h3-4H,1-2,5-6H2 |
| InChIKey | MVMPAXRRHYFQFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione?
The IUPAC name of 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione (CID 15620660) is 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione.
What is the SMILES notation for 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione?
The canonical SMILES for 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione is C=CCN1C(=O)N(CC=C)C1=O.
What is the InChIKey of 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione?
The InChIKey is MVMPAXRRHYFQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-3-5-9-7(11)10(6-4-2)8(9)12/h3-4H,1-2,5-6H2.
What are the key properties of 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione?
1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione has a molecular weight of 166.18 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(prop-2-enyl)-1,3-diazetidine-2,4-dione is sourced from PubChem (CID 15620660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).