About 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole
2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole (PubChem CID 15620725) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole |
| PubChem CID | 15620725 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole |
| SMILES | c1cc(-c2nnco2)[nH]n1 |
| InChI | InChI=1S/C5H4N4O/c1-2-6-8-4(1)5-9-7-3-10-5/h1-3H,(H,6,8) |
| InChIKey | INTQYOMRTBXQRY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole (CID 15620725) is 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole is c1cc(-c2nnco2)[nH]n1.
What is the InChIKey of 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole?
The InChIKey is INTQYOMRTBXQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c1-2-6-8-4(1)5-9-7-3-10-5/h1-3H,(H,6,8).
What are the key properties of 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole?
2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole has a molecular weight of 136.11 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-5-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 15620725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).