About 2-cyclohexyloxane
2-cyclohexyloxane (PubChem CID 15620793) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-cyclohexyloxane.
Molecular Properties
| Compound Name | 2-cyclohexyloxane |
| PubChem CID | 15620793 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 2-cyclohexyloxane |
| SMILES | C1CCC(C2CCCCO2)CC1 |
| InChI | InChI=1S/C11H20O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h10-11H,1-9H2 |
| InChIKey | URUKMUHHWWCNKS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxane?
The IUPAC name of 2-cyclohexyloxane (CID 15620793) is 2-cyclohexyloxane.
What is the SMILES notation for 2-cyclohexyloxane?
The canonical SMILES for 2-cyclohexyloxane is C1CCC(C2CCCCO2)CC1.
What is the InChIKey of 2-cyclohexyloxane?
The InChIKey is URUKMUHHWWCNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h10-11H,1-9H2.
What are the key properties of 2-cyclohexyloxane?
2-cyclohexyloxane has a molecular weight of 168.28 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxane is sourced from PubChem (CID 15620793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).