About 3,5-di(propan-2-yl)-1,2-thiazole
3,5-di(propan-2-yl)-1,2-thiazole (PubChem CID 15621352) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 3,5-di(propan-2-yl)-1,2-thiazole.
Molecular Properties
| Compound Name | 3,5-di(propan-2-yl)-1,2-thiazole |
| PubChem CID | 15621352 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3,5-di(propan-2-yl)-1,2-thiazole |
| SMILES | CC(C)c1cc(C(C)C)sn1 |
| InChI | InChI=1S/C9H15NS/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3 |
| InChIKey | CFCZRTDTLBXMPO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-di(propan-2-yl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(propan-2-yl)-1,2-thiazole?
The IUPAC name of 3,5-di(propan-2-yl)-1,2-thiazole (CID 15621352) is 3,5-di(propan-2-yl)-1,2-thiazole.
What is the SMILES notation for 3,5-di(propan-2-yl)-1,2-thiazole?
The canonical SMILES for 3,5-di(propan-2-yl)-1,2-thiazole is CC(C)c1cc(C(C)C)sn1.
What is the InChIKey of 3,5-di(propan-2-yl)-1,2-thiazole?
The InChIKey is CFCZRTDTLBXMPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3.
What are the key properties of 3,5-di(propan-2-yl)-1,2-thiazole?
3,5-di(propan-2-yl)-1,2-thiazole has a molecular weight of 169.29 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(propan-2-yl)-1,2-thiazole is sourced from PubChem (CID 15621352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).