C11H16O3 — CID 15621670
6,6,7a-trimethyl-3,3a,5,7-tetrahydro-1-benzofuran-2,4-dione (PubChem CID 15621670) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 6,6,7a-trimethyl-3,3a,5,7-tetrahydro-1-benzofuran-2,4-dione.
| Compound Name | 6,6,7a-trimethyl-3,3a,5,7-tetrahydro-1-benzofuran-2,4-dione |
|---|---|
| PubChem CID | 15621670 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 6,6,7a-trimethyl-3,3a,5,7-tetrahydro-1-benzofuran-2,4-dione |
| SMILES | CC1(C)CC(=O)C2CC(=O)OC2(C)C1 |
| InChI | InChI=1S/C11H16O3/c1-10(2)5-8(12)7-4-9(13)14-11(7,3)6-10/h7H,4-6H2,1-3H3 |
| InChIKey | ULGUBVQOTOTNAA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |