C21H24FN3O3S — CID 15622253
4-fluoro-N-[3-[(6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-yl)amino]propyl]benzenesulfonamide (PubChem CID 15622253) has the molecular formula C21H24FN3O3S and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-fluoro-N-[3-[(6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-yl)amino]propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[(6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-yl)amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 15622253 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-fluoro-N-[3-[(6-methoxy-1,3,4,5-tetrahydrobenzo[cd]indol-4-yl)amino]propyl]benzenesulfonamide |
| SMILES | COc1ccc2[nH]cc3c2c1CC(NCCCNS(=O)(=O)c1ccc(F)cc1)C3 |
| InChI | InChI=1S/C21H24FN3O3S/c1-28-20-8-7-19-21-14(13-24-19)11-16(12-18(20)21)23-9-2-10-25-29(26,27)17-5-3-15(22)4-6-17/h3-8,13,16,23-25H,2,9-12H2,1H3 |
| InChIKey | NKAZCFXGFFFKGP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|