C13H22O2 — CID 15624539
4-[(E)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one (PubChem CID 15624539) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-[(E)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one.
| Compound Name | 4-[(E)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 15624539 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-[(E)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one |
| SMILES | CC(O)/C=C/C1C(C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C13H22O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h5-6,9-10,12,14H,7-8H2,1-4H3/b6-5+ |
| InChIKey | WFSOPDPEWLYCRX-AATRIKPKSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|