C18H12I2N2O2 — CID 15625433
(1S,11S)-5,15-diiodo-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaene-2,12-dione (PubChem CID 15625433) has the molecular formula C18H12I2N2O2 and a molecular weight of 542.11 g/mol. Its IUPAC name is (1S,11S)-5,15-diiodo-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaene-2,12-dione.
| Compound Name | (1S,11S)-5,15-diiodo-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaene-2,12-dione |
|---|---|
| PubChem CID | 15625433 |
| Molecular Formula | C18H12I2N2O2 |
| Molecular Weight | 542.11 g/mol |
| Exact Mass | 541.90 |
| IUPAC Name | (1S,11S)-5,15-diiodo-3,13-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaene-2,12-dione |
| SMILES | O=C1[C@@H]2Cc3cccc(I)c3N2C(=O)[C@@H]2Cc3cccc(I)c3N12 |
| InChI | InChI=1S/C18H12I2N2O2/c19-11-5-1-3-9-7-13-17(23)22-14(18(24)21(13)15(9)11)8-10-4-2-6-12(20)16(10)22/h1-6,13-14H,7-8H2/t13-,14-/m0/s1 |
| InChIKey | NPTAJZONSGQTDP-KBPBESRZSA-N |
| XLogP | 3.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|