C21H22ClN3O7S — CID 15627926
3-(acetyloxymethyl)-7-[3-[(E)-1-(4-chlorophenyl)ethylideneamino]oxypropanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 15627926) has the molecular formula C21H22ClN3O7S and a molecular weight of 495.94 g/mol. Its IUPAC name is 3-(acetyloxymethyl)-7-[3-[(E)-1-(4-chlorophenyl)ethylideneamino]oxypropanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(acetyloxymethyl)-7-[3-[(E)-1-(4-chlorophenyl)ethylideneamino]oxypropanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 15627926 |
| Molecular Formula | C21H22ClN3O7S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 3-(acetyloxymethyl)-7-[3-[(E)-1-(4-chlorophenyl)ethylideneamino]oxypropanoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)CCO/N=C(\C)c3ccc(Cl)cc3)C2SC1 |
| InChI | InChI=1S/C21H22ClN3O7S/c1-11(13-3-5-15(22)6-4-13)24-32-8-7-16(27)23-17-19(28)25-18(21(29)30)14(9-31-12(2)26)10-33-20(17)25/h3-6,17,20H,7-10H2,1-2H3,(H,23,27)(H,29,30)/b24-11+ |
| InChIKey | WCMBHINJUROAKA-BHGWPJFGSA-N |
| XLogP | 1.77 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|