About propan-2-yl carbamate
propan-2-yl carbamate (PubChem CID 15628) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is propan-2-yl carbamate.
Molecular Properties
| Compound Name | propan-2-yl carbamate |
| PubChem CID | 15628 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | propan-2-yl carbamate |
| SMILES | CC(C)OC(N)=O |
| InChI | InChI=1S/C4H9NO2/c1-3(2)7-4(5)6/h3H,1-2H3,(H2,5,6) |
| InChIKey | OVPLZYJGTGDFNB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl carbamate?
The IUPAC name of propan-2-yl carbamate (CID 15628) is propan-2-yl carbamate.
What is the SMILES notation for propan-2-yl carbamate?
The canonical SMILES for propan-2-yl carbamate is CC(C)OC(N)=O.
What is the InChIKey of propan-2-yl carbamate?
The InChIKey is OVPLZYJGTGDFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c1-3(2)7-4(5)6/h3H,1-2H3,(H2,5,6).
What are the key properties of propan-2-yl carbamate?
propan-2-yl carbamate has a molecular weight of 103.12 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl carbamate is sourced from PubChem (CID 15628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).