C23H32N2O5S — CID 15628381
benzyl N-[(2S)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-3-oxopropyl]-N-methylcarbamate (PubChem CID 15628381) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is benzyl N-[(2S)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-3-oxopropyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(2S)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-3-oxopropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 15628381 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | benzyl N-[(2S)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-3-oxopropyl]-N-methylcarbamate |
| SMILES | C[C@@H](CN(C)C(=O)OCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C23H32N2O5S/c1-16(13-24(4)21(27)30-14-17-8-6-5-7-9-17)20(26)25-19-12-18-10-11-23(19,22(18,2)3)15-31(25,28)29/h5-9,16,18-19H,10-15H2,1-4H3/t16-,18+,19+,23+/m0/s1 |
| InChIKey | GTYIZRAENAHJRT-OSJYTEGDSA-N |
| XLogP | 3.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |