C17H14F3NS — CID 15628565
1-methyl-4-(trifluoromethylsulfanyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene (PubChem CID 15628565) has the molecular formula C17H14F3NS and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-methyl-4-(trifluoromethylsulfanyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene.
| Compound Name | 1-methyl-4-(trifluoromethylsulfanyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene |
|---|---|
| PubChem CID | 15628565 |
| Molecular Formula | C17H14F3NS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-methyl-4-(trifluoromethylsulfanyl)-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10,12,14-hexaene |
| SMILES | CC12NC(Cc3ccc(SC(F)(F)F)cc31)c1ccccc12 |
| InChI | InChI=1S/C17H14F3NS/c1-16-13-5-3-2-4-12(13)15(21-16)8-10-6-7-11(9-14(10)16)22-17(18,19)20/h2-7,9,15,21H,8H2,1H3 |
| InChIKey | KQGHDHYNEHDWBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |