C16H19N — CID 15628834
(9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),10,12,14-tetraene (PubChem CID 15628834) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is (9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),10,12,14-tetraene.
| Compound Name | (9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),10,12,14-tetraene |
|---|---|
| PubChem CID | 15628834 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (9R)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),10,12,14-tetraene |
| SMILES | CC12N[C@H](CC3=C1CCCC3)c1ccccc12 |
| InChI | InChI=1S/C16H19N/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16/h3,5,7,9,15,17H,2,4,6,8,10H2,1H3/t15-,16?/m1/s1 |
| InChIKey | DNQMEVZYRQESJN-AAFJCEBUSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|