About 6,8-dihydro-5H-pyrano[3,4-b]pyridine
6,8-dihydro-5H-pyrano[3,4-b]pyridine (PubChem CID 15630036) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 6,8-dihydro-5H-pyrano[3,4-b]pyridine.
Molecular Properties
| Compound Name | 6,8-dihydro-5H-pyrano[3,4-b]pyridine |
| PubChem CID | 15630036 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 6,8-dihydro-5H-pyrano[3,4-b]pyridine |
| SMILES | c1cnc2c(c1)CCOC2 |
| InChI | InChI=1S/C8H9NO/c1-2-7-3-5-10-6-8(7)9-4-1/h1-2,4H,3,5-6H2 |
| InChIKey | YWIHMXWDEWRBLK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dihydro-5H-pyrano[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydro-5H-pyrano[3,4-b]pyridine?
The IUPAC name of 6,8-dihydro-5H-pyrano[3,4-b]pyridine (CID 15630036) is 6,8-dihydro-5H-pyrano[3,4-b]pyridine.
What is the SMILES notation for 6,8-dihydro-5H-pyrano[3,4-b]pyridine?
The canonical SMILES for 6,8-dihydro-5H-pyrano[3,4-b]pyridine is c1cnc2c(c1)CCOC2.
What is the InChIKey of 6,8-dihydro-5H-pyrano[3,4-b]pyridine?
The InChIKey is YWIHMXWDEWRBLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-2-7-3-5-10-6-8(7)9-4-1/h1-2,4H,3,5-6H2.
What are the key properties of 6,8-dihydro-5H-pyrano[3,4-b]pyridine?
6,8-dihydro-5H-pyrano[3,4-b]pyridine has a molecular weight of 135.17 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydro-5H-pyrano[3,4-b]pyridine is sourced from PubChem (CID 15630036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).