C23H48OSiSn — CID 15630112
tert-butyl-dimethyl-(3-tributylstannylcyclopent-2-en-1-yl)oxysilane (PubChem CID 15630112) has the molecular formula C23H48OSiSn and a molecular weight of 487.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-tributylstannylcyclopent-2-en-1-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(3-tributylstannylcyclopent-2-en-1-yl)oxysilane |
|---|---|
| PubChem CID | 15630112 |
| Molecular Formula | C23H48OSiSn |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | tert-butyl-dimethyl-(3-tributylstannylcyclopent-2-en-1-yl)oxysilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H21OSi.3C4H9.Sn/c1-11(2,3)13(4,5)12-10-8-6-7-9-10;3*1-3-4-2;/h9-10H,6,8H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | ZZDUANMDXCZMTP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|