About methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate
methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate (PubChem CID 15630152) has the molecular formula C14H13N2O2+
and a molecular weight of 241.27 g/mol. Its IUPAC name is methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| PubChem CID | 15630152 |
| Molecular Formula | C14H13N2O2+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| SMILES | COC(=O)c1cc2c(c[n+]1C)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H12N2O2/c1-16-8-12-10(7-13(16)14(17)18-2)9-5-3-4-6-11(9)15-12/h3-8H,1-2H3/p+1 |
| InChIKey | UUMQQVGTICTWCW-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate?
The IUPAC name of methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate (CID 15630152) is methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
What is the SMILES notation for methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate?
The canonical SMILES for methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate is COC(=O)c1cc2c(c[n+]1C)[nH]c1ccccc12.
What is the InChIKey of methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate?
The InChIKey is UUMQQVGTICTWCW-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H12N2O2/c1-16-8-12-10(7-13(16)14(17)18-2)9-5-3-4-6-11(9)15-12/h3-8H,1-2H3/p+1.
What are the key properties of methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate?
methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate has a molecular weight of 241.27 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-carboxylate is sourced from PubChem (CID 15630152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).