C21H17FN2O2 — CID 15630176
ethyl 2-[(4-fluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 15630176) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 2-[(4-fluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 15630176 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c3ccccc3nc-2cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O2/c1-2-26-21(25)20-11-17-16-5-3-4-6-18(16)23-19(17)13-24(20)12-14-7-9-15(22)10-8-14/h3-11,13H,2,12H2,1H3 |
| InChIKey | UUNCYPBZTLKBNJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |