About 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid
2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid (PubChem CID 15630343) has the molecular formula C12H15O12S3Sb
and a molecular weight of 569.20 g/mol. Its IUPAC name is 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid.
Molecular Properties
| Compound Name | 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid |
| PubChem CID | 15630343 |
| Molecular Formula | C12H15O12S3Sb |
| Molecular Weight | 569.20 g/mol |
| Exact Mass | 567.88 |
| IUPAC Name | 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid |
| SMILES | O=C(O)CC(S[Sb](SC(CC(=O)O)C(=O)O)SC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/3C4H6O4S.Sb/c3*5-3(6)1-2(9)4(7)8;/h3*2,9H,1H2,(H,5,6)(H,7,8);/q;;;+3/p-3 |
| InChIKey | RIQPOGDQSKYVFD-UHFFFAOYSA-K |
| XLogP | -0.05 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid?
The IUPAC name of 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid (CID 15630343) is 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid.
What is the SMILES notation for 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid?
The canonical SMILES for 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid is O=C(O)CC(S[Sb](SC(CC(=O)O)C(=O)O)SC(CC(=O)O)C(=O)O)C(=O)O.
What is the InChIKey of 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid?
The InChIKey is RIQPOGDQSKYVFD-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H6O4S.Sb/c3*5-3(6)1-2(9)4(7)8;/h3*2,9H,1H2,(H,5,6)(H,7,8);/q;;;+3/p-3.
What are the key properties of 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid?
2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid has a molecular weight of 569.20 g/mol, XLogP of -0.05, 15 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(1,2-dicarboxyethylsulfanyl)stibanylsulfanyl]butanedioic acid is sourced from PubChem (CID 15630343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).