About 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one
4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 15630906) has the molecular formula C7H11NO2S2
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 15630906 |
| Molecular Formula | C7H11NO2S2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CC2SCCS2)CO1 |
| InChI | InChI=1S/C7H11NO2S2/c9-7-8-5(4-10-7)3-6-11-1-2-12-6/h5-6H,1-4H2,(H,8,9) |
| InChIKey | RFRHJEOLUNWZAY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one (CID 15630906) is 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one is O=C1NC(CC2SCCS2)CO1.
What is the InChIKey of 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one?
The InChIKey is RFRHJEOLUNWZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S2/c9-7-8-5(4-10-7)3-6-11-1-2-12-6/h5-6H,1-4H2,(H,8,9).
What are the key properties of 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one?
4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one has a molecular weight of 205.30 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithiolan-2-ylmethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 15630906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).