About 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol
3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol (PubChem CID 15631236) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol.
Molecular Properties
| Compound Name | 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol |
| PubChem CID | 15631236 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol |
| SMILES | CC(C)CC(N)C(C)(O)COC(C)(C)C |
| InChI | InChI=1S/C12H27NO2/c1-9(2)7-10(13)12(6,14)8-15-11(3,4)5/h9-10,14H,7-8,13H2,1-6H3 |
| InChIKey | ATVNXZBITZRRLR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol?
The IUPAC name of 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol (CID 15631236) is 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol.
What is the SMILES notation for 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol?
The canonical SMILES for 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol is CC(C)CC(N)C(C)(O)COC(C)(C)C.
What is the InChIKey of 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol?
The InChIKey is ATVNXZBITZRRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-9(2)7-10(13)12(6,14)8-15-11(3,4)5/h9-10,14H,7-8,13H2,1-6H3.
What are the key properties of 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol?
3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol has a molecular weight of 217.35 g/mol, XLogP of 1.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,5-dimethyl-1-[(2-methylpropan-2-yl)oxy]hexan-2-ol is sourced from PubChem (CID 15631236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).