C37H37NO8 — CID 15631464
[4-benzoyloxy-2,3-dimethoxy-6-methyl-5-(4-morpholin-4-yl-4-oxo-1-phenylbutyl)phenyl] benzoate (PubChem CID 15631464) has the molecular formula C37H37NO8 and a molecular weight of 623.70 g/mol. Its IUPAC name is [4-benzoyloxy-2,3-dimethoxy-6-methyl-5-(4-morpholin-4-yl-4-oxo-1-phenylbutyl)phenyl] benzoate.
| Compound Name | [4-benzoyloxy-2,3-dimethoxy-6-methyl-5-(4-morpholin-4-yl-4-oxo-1-phenylbutyl)phenyl] benzoate |
|---|---|
| PubChem CID | 15631464 |
| Molecular Formula | C37H37NO8 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | [4-benzoyloxy-2,3-dimethoxy-6-methyl-5-(4-morpholin-4-yl-4-oxo-1-phenylbutyl)phenyl] benzoate |
| SMILES | COc1c(OC(=O)c2ccccc2)c(C)c(C(CCC(=O)N2CCOCC2)c2ccccc2)c(OC(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C37H37NO8/c1-25-31(29(26-13-7-4-8-14-26)19-20-30(39)38-21-23-44-24-22-38)33(46-37(41)28-17-11-6-12-18-28)35(43-3)34(42-2)32(25)45-36(40)27-15-9-5-10-16-27/h4-18,29H,19-24H2,1-3H3 |
| InChIKey | LVXNGQJWRVFSHP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|