About 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine
7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine (PubChem CID 15631968) has the molecular formula C18H23ClN4
and a molecular weight of 330.86 g/mol. Its IUPAC name is 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine.
Molecular Properties
| Compound Name | 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine |
| PubChem CID | 15631968 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine |
| SMILES | CN1CCN(c2c3c(nc4cc(Cl)ccc24)CCN(C)C3)CC1 |
| InChI | InChI=1S/C18H23ClN4/c1-21-7-9-23(10-8-21)18-14-4-3-13(19)11-17(14)20-16-5-6-22(2)12-15(16)18/h3-4,11H,5-10,12H2,1-2H3 |
| InChIKey | TXJKCTCFWXWKSI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The IUPAC name of 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine (CID 15631968) is 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine.
What is the SMILES notation for 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The canonical SMILES for 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine is CN1CCN(c2c3c(nc4cc(Cl)ccc24)CCN(C)C3)CC1.
What is the InChIKey of 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The InChIKey is TXJKCTCFWXWKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23ClN4/c1-21-7-9-23(10-8-21)18-14-4-3-13(19)11-17(14)20-16-5-6-22(2)12-15(16)18/h3-4,11H,5-10,12H2,1-2H3.
What are the key properties of 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine has a molecular weight of 330.86 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-methyl-10-(4-methylpiperazin-1-yl)-3,4-dihydro-1H-benzo[b][1,6]naphthyridine is sourced from PubChem (CID 15631968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).