C13H15ClN4 — CID 15631971
(8-chloro-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)hydrazine (PubChem CID 15631971) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is (8-chloro-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)hydrazine.
| Compound Name | (8-chloro-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)hydrazine |
|---|---|
| PubChem CID | 15631971 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (8-chloro-2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-10-yl)hydrazine |
| SMILES | CN1CCc2nc3ccc(Cl)cc3c(NN)c2C1 |
| InChI | InChI=1S/C13H15ClN4/c1-18-5-4-12-10(7-18)13(17-15)9-6-8(14)2-3-11(9)16-12/h2-3,6H,4-5,7,15H2,1H3,(H,16,17) |
| InChIKey | XNLMJPNBNFZCRC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|