C23H28SSi — CID 15632380
[(1E)-1-(3,3-diphenylthiiran-2-ylidene)-2,2-dimethylbut-3-enyl]-trimethylsilane (PubChem CID 15632380) has the molecular formula C23H28SSi and a molecular weight of 364.63 g/mol. Its IUPAC name is [(1E)-1-(3,3-diphenylthiiran-2-ylidene)-2,2-dimethylbut-3-enyl]-trimethylsilane.
| Compound Name | [(1E)-1-(3,3-diphenylthiiran-2-ylidene)-2,2-dimethylbut-3-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 15632380 |
| Molecular Formula | C23H28SSi |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(1E)-1-(3,3-diphenylthiiran-2-ylidene)-2,2-dimethylbut-3-enyl]-trimethylsilane |
| SMILES | C=CC(C)(C)/C(=C1\SC1(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H28SSi/c1-7-22(2,3)21(25(4,5)6)20-23(24-20,18-14-10-8-11-15-18)19-16-12-9-13-17-19/h7-17H,1H2,2-6H3/b21-20+ |
| InChIKey | GJNWPYQZJRMTSK-QZQOTICOSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|