C9H14O4 — CID 15632539
5-ethenyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 15632539) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 5-ethenyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 5-ethenyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 15632539 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-ethenyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=CC1OC(C)(C)OC1(C)C(=O)O |
| InChI | InChI=1S/C9H14O4/c1-5-6-9(4,7(10)11)13-8(2,3)12-6/h5-6H,1H2,2-4H3,(H,10,11) |
| InChIKey | DSRWLBPRTIUKFM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|