C12H23N3 — CID 15633074
N,N,5,5-tetramethyl-2-pentan-3-ylimidazol-4-amine (PubChem CID 15633074) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N,N,5,5-tetramethyl-2-pentan-3-ylimidazol-4-amine.
| Compound Name | N,N,5,5-tetramethyl-2-pentan-3-ylimidazol-4-amine |
|---|---|
| PubChem CID | 15633074 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N,N,5,5-tetramethyl-2-pentan-3-ylimidazol-4-amine |
| SMILES | CCC(CC)C1=NC(C)(C)C(N(C)C)=N1 |
| InChI | InChI=1S/C12H23N3/c1-7-9(8-2)10-13-11(15(5)6)12(3,4)14-10/h9H,7-8H2,1-6H3 |
| InChIKey | RARXHDZNCHMGKI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |