(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate

C8H12N2S2 — CID 15633172

IUPAC(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate
SMILESCC(C)(SC#N)C(C)(C)SC#N
InChIInChI=1S/C8H12N2S2/c1-7(2,11-5-9)8(3,4)12-6-10/h1-4H3
InChIKeyHEMWVQLDSYTXCC-UHFFFAOYSA-N
MW200.33 g/mol
LogP2.97
Rot. Bonds3

About (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate

(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate (PubChem CID 15633172) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate.

Molecular Properties

Compound Name(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate
PubChem CID15633172
Molecular FormulaC8H12N2S2
Molecular Weight200.33 g/mol
Exact Mass200.04
IUPAC Name(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate
SMILESCC(C)(SC#N)C(C)(C)SC#N
InChIInChI=1S/C8H12N2S2/c1-7(2,11-5-9)8(3,4)12-6-10/h1-4H3
InChIKeyHEMWVQLDSYTXCC-UHFFFAOYSA-N
XLogP2.97
TPSA47.58 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.33
LogP ≤ 52.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}

Analyze (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate?
The IUPAC name of (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate (CID 15633172) is (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate.
What is the SMILES notation for (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate?
The canonical SMILES for (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate is CC(C)(SC#N)C(C)(C)SC#N.
What is the InChIKey of (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate?
The InChIKey is HEMWVQLDSYTXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-7(2,11-5-9)8(3,4)12-6-10/h1-4H3.
What are the key properties of (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate?
(2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate has a molecular weight of 200.33 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-3-thiocyanatobutan-2-yl) thiocyanate is sourced from PubChem (CID 15633172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).