C16H17ClF3N3 — CID 15633482
[4-chloro-3-(trifluoromethyl)phenyl]-(3,4,6,7,8,9-hexahydro-2H-quinolizin-1-yl)diazene (PubChem CID 15633482) has the molecular formula C16H17ClF3N3 and a molecular weight of 343.78 g/mol. Its IUPAC name is [4-chloro-3-(trifluoromethyl)phenyl]-(3,4,6,7,8,9-hexahydro-2H-quinolizin-1-yl)diazene.
| Compound Name | [4-chloro-3-(trifluoromethyl)phenyl]-(3,4,6,7,8,9-hexahydro-2H-quinolizin-1-yl)diazene |
|---|---|
| PubChem CID | 15633482 |
| Molecular Formula | C16H17ClF3N3 |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl]-(3,4,6,7,8,9-hexahydro-2H-quinolizin-1-yl)diazene |
| SMILES | FC(F)(F)c1cc(/N=N/C2=C3CCCCN3CCC2)ccc1Cl |
| InChI | InChI=1S/C16H17ClF3N3/c17-13-7-6-11(10-12(13)16(18,19)20)21-22-14-4-3-9-23-8-2-1-5-15(14)23/h6-7,10H,1-5,8-9H2/b22-21+ |
| InChIKey | BWQKCLCDJDLDKH-QURGRASLSA-N |
| XLogP | 5.93 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|