About (1E)-1-methoxy-7-methylocta-1,6-diene
(1E)-1-methoxy-7-methylocta-1,6-diene (PubChem CID 15633717) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (1E)-1-methoxy-7-methylocta-1,6-diene.
Molecular Properties
| Compound Name | (1E)-1-methoxy-7-methylocta-1,6-diene |
| PubChem CID | 15633717 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (1E)-1-methoxy-7-methylocta-1,6-diene |
| SMILES | CO/C=C/CCCC=C(C)C |
| InChI | InChI=1S/C10H18O/c1-10(2)8-6-4-5-7-9-11-3/h7-9H,4-6H2,1-3H3/b9-7+ |
| InChIKey | ZKGWPONGWWMTFS-VQHVLOKHSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-methoxy-7-methylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-methoxy-7-methylocta-1,6-diene?
The IUPAC name of (1E)-1-methoxy-7-methylocta-1,6-diene (CID 15633717) is (1E)-1-methoxy-7-methylocta-1,6-diene.
What is the SMILES notation for (1E)-1-methoxy-7-methylocta-1,6-diene?
The canonical SMILES for (1E)-1-methoxy-7-methylocta-1,6-diene is CO/C=C/CCCC=C(C)C.
What is the InChIKey of (1E)-1-methoxy-7-methylocta-1,6-diene?
The InChIKey is ZKGWPONGWWMTFS-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H18O/c1-10(2)8-6-4-5-7-9-11-3/h7-9H,4-6H2,1-3H3/b9-7+.
What are the key properties of (1E)-1-methoxy-7-methylocta-1,6-diene?
(1E)-1-methoxy-7-methylocta-1,6-diene has a molecular weight of 154.25 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-methoxy-7-methylocta-1,6-diene is sourced from PubChem (CID 15633717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).