About 2-(tributyl-λ5-phosphanylidene)propanal
2-(tributyl-λ5-phosphanylidene)propanal (PubChem CID 15633969) has the molecular formula C15H31OP
and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-(tributyl-λ5-phosphanylidene)propanal.
Molecular Properties
| Compound Name | 2-(tributyl-λ5-phosphanylidene)propanal |
| PubChem CID | 15633969 |
| Molecular Formula | C15H31OP |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-(tributyl-λ5-phosphanylidene)propanal |
| SMILES | CCCCP(CCCC)(CCCC)=C(C)C=O |
| InChI | InChI=1S/C15H31OP/c1-5-8-11-17(12-9-6-2,13-10-7-3)15(4)14-16/h14H,5-13H2,1-4H3 |
| InChIKey | BSWSJMFKRRQGQW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(tributyl-λ5-phosphanylidene)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tributyl-λ5-phosphanylidene)propanal?
The IUPAC name of 2-(tributyl-λ5-phosphanylidene)propanal (CID 15633969) is 2-(tributyl-λ5-phosphanylidene)propanal.
What is the SMILES notation for 2-(tributyl-λ5-phosphanylidene)propanal?
The canonical SMILES for 2-(tributyl-λ5-phosphanylidene)propanal is CCCCP(CCCC)(CCCC)=C(C)C=O.
What is the InChIKey of 2-(tributyl-λ5-phosphanylidene)propanal?
The InChIKey is BSWSJMFKRRQGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31OP/c1-5-8-11-17(12-9-6-2,13-10-7-3)15(4)14-16/h14H,5-13H2,1-4H3.
What are the key properties of 2-(tributyl-λ5-phosphanylidene)propanal?
2-(tributyl-λ5-phosphanylidene)propanal has a molecular weight of 258.39 g/mol, XLogP of 4.80, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tributyl-λ5-phosphanylidene)propanal is sourced from PubChem (CID 15633969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).