About diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate
diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate (PubChem CID 15634042) has the molecular formula C21H29IO4
and a molecular weight of 472.36 g/mol. Its IUPAC name is diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate |
| PubChem CID | 15634042 |
| Molecular Formula | C21H29IO4 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate |
| SMILES | C=CCC#CCC(C/C=C(\I)CCC(=C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H29IO4/c1-6-9-10-11-15-21(19(23)25-7-2,20(24)26-8-3)16-14-18(22)13-12-17(4)5/h6,14H,1,4,7-9,12-13,15-16H2,2-3,5H3/b18-14- |
| InChIKey | FXWGURKQFRONNH-JXAWBTAJSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate?
The IUPAC name of diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate (CID 15634042) is diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate.
What is the SMILES notation for diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate?
The canonical SMILES for diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate is C=CCC#CCC(C/C=C(\I)CCC(=C)C)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate?
The InChIKey is FXWGURKQFRONNH-JXAWBTAJSA-N. The full InChI is InChI=1S/C21H29IO4/c1-6-9-10-11-15-21(19(23)25-7-2,20(24)26-8-3)16-14-18(22)13-12-17(4)5/h6,14H,1,4,7-9,12-13,15-16H2,2-3,5H3/b18-14-.
What are the key properties of diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate?
diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate has a molecular weight of 472.36 g/mol, XLogP of 5.13, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-hex-5-en-2-ynyl-2-[(2Z)-3-iodo-6-methylhepta-2,6-dienyl]propanedioate is sourced from PubChem (CID 15634042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).