About diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate
diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate (PubChem CID 15634043) has the molecular formula C25H33IO4
and a molecular weight of 524.44 g/mol. Its IUPAC name is diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate |
| PubChem CID | 15634043 |
| Molecular Formula | C25H33IO4 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate |
| SMILES | C=CCC#CCC/C(I)=C/CC(CC#CCCC(=C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H33IO4/c1-6-9-10-11-14-17-22(26)18-20-25(23(27)29-7-2,24(28)30-8-3)19-15-12-13-16-21(4)5/h6,18H,1,4,7-9,13-14,16-17,19-20H2,2-3,5H3/b22-18- |
| InChIKey | WVVZWNIGMNJESN-PYCFMQQDSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate?
The IUPAC name of diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate (CID 15634043) is diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate.
What is the SMILES notation for diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate?
The canonical SMILES for diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate is C=CCC#CCC/C(I)=C/CC(CC#CCCC(=C)C)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate?
The InChIKey is WVVZWNIGMNJESN-PYCFMQQDSA-N. The full InChI is InChI=1S/C25H33IO4/c1-6-9-10-11-14-17-22(26)18-20-25(23(27)29-7-2,24(28)30-8-3)19-15-12-13-16-21(4)5/h6,18H,1,4,7-9,13-14,16-17,19-20H2,2-3,5H3/b22-18-.
What are the key properties of diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate?
diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate has a molecular weight of 524.44 g/mol, XLogP of 5.92, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(2Z)-3-iododeca-2,9-dien-6-ynyl]-2-(6-methylhept-6-en-2-ynyl)propanedioate is sourced from PubChem (CID 15634043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).