About 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine
4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine (PubChem CID 15634152) has the molecular formula C22H42N2O
and a molecular weight of 350.59 g/mol. Its IUPAC name is 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine |
| PubChem CID | 15634152 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine |
| SMILES | CCCC1(CCC)CCC2(CCN(CCCN3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C22H42N2O/c1-3-6-21(7-4-2)8-10-22(11-9-21)12-15-24(20-22)14-5-13-23-16-18-25-19-17-23/h3-20H2,1-2H3 |
| InChIKey | DUBUZWPTDBFHGL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine?
The IUPAC name of 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine (CID 15634152) is 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine.
What is the SMILES notation for 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine?
The canonical SMILES for 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine is CCCC1(CCC)CCC2(CCN(CCCN3CCOCC3)C2)CC1.
What is the InChIKey of 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine?
The InChIKey is DUBUZWPTDBFHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2O/c1-3-6-21(7-4-2)8-10-22(11-9-21)12-15-24(20-22)14-5-13-23-16-18-25-19-17-23/h3-20H2,1-2H3.
What are the key properties of 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine?
4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine has a molecular weight of 350.59 g/mol, XLogP of 4.56, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(8,8-dipropyl-2-azaspiro[4.5]decan-2-yl)propyl]morpholine is sourced from PubChem (CID 15634152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).