About tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane
tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane (PubChem CID 15634407) has the molecular formula C22H44O3Sn
and a molecular weight of 475.30 g/mol. Its IUPAC name is tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane |
| PubChem CID | 15634407 |
| Molecular Formula | C22H44O3Sn |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane |
| SMILES | CCCC[Sn](C/C=C/OCCCC1OCCCO1)(CCCC)CCCC |
| InChI | InChI=1S/C10H17O3.3C4H9.Sn/c1-2-6-11-7-3-5-10-12-8-4-9-13-10;3*1-3-4-2;/h2,6,10H,1,3-5,7-9H2;3*1,3-4H2,2H3;/b6-2+;;;; |
| InChIKey | KJKBGNFMLQCOAV-GGDCSFEBSA-N |
| XLogP | 6.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane?
The IUPAC name of tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane (CID 15634407) is tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane.
What is the SMILES notation for tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane?
The canonical SMILES for tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane is CCCC[Sn](C/C=C/OCCCC1OCCCO1)(CCCC)CCCC.
What is the InChIKey of tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane?
The InChIKey is KJKBGNFMLQCOAV-GGDCSFEBSA-N. The full InChI is InChI=1S/C10H17O3.3C4H9.Sn/c1-2-6-11-7-3-5-10-12-8-4-9-13-10;3*1-3-4-2;/h2,6,10H,1,3-5,7-9H2;3*1,3-4H2,2H3;/b6-2+;;;;.
What are the key properties of tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane?
tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane has a molecular weight of 475.30 g/mol, XLogP of 6.91, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(E)-3-[3-(1,3-dioxan-2-yl)propoxy]prop-2-enyl]stannane is sourced from PubChem (CID 15634407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).