About (E)-7,7-dimethoxyhept-5-enal
(E)-7,7-dimethoxyhept-5-enal (PubChem CID 15635090) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is (E)-7,7-dimethoxyhept-5-enal.
Molecular Properties
| Compound Name | (E)-7,7-dimethoxyhept-5-enal |
| PubChem CID | 15635090 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (E)-7,7-dimethoxyhept-5-enal |
| SMILES | COC(/C=C/CCCC=O)OC |
| InChI | InChI=1S/C9H16O3/c1-11-9(12-2)7-5-3-4-6-8-10/h5,7-9H,3-4,6H2,1-2H3/b7-5+ |
| InChIKey | ZLLDAWWGISHUFU-FNORWQNLSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7,7-dimethoxyhept-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7,7-dimethoxyhept-5-enal?
The IUPAC name of (E)-7,7-dimethoxyhept-5-enal (CID 15635090) is (E)-7,7-dimethoxyhept-5-enal.
What is the SMILES notation for (E)-7,7-dimethoxyhept-5-enal?
The canonical SMILES for (E)-7,7-dimethoxyhept-5-enal is COC(/C=C/CCCC=O)OC.
What is the InChIKey of (E)-7,7-dimethoxyhept-5-enal?
The InChIKey is ZLLDAWWGISHUFU-FNORWQNLSA-N. The full InChI is InChI=1S/C9H16O3/c1-11-9(12-2)7-5-3-4-6-8-10/h5,7-9H,3-4,6H2,1-2H3/b7-5+.
What are the key properties of (E)-7,7-dimethoxyhept-5-enal?
(E)-7,7-dimethoxyhept-5-enal has a molecular weight of 172.22 g/mol, XLogP of 1.53, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,7-dimethoxyhept-5-enal is sourced from PubChem (CID 15635090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).