C20H19N3O2 — CID 15635121
6-(2-ethenyl-4,5-dimethoxyphenyl)-2-phenylpyrimidin-4-amine (PubChem CID 15635121) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-(2-ethenyl-4,5-dimethoxyphenyl)-2-phenylpyrimidin-4-amine.
| Compound Name | 6-(2-ethenyl-4,5-dimethoxyphenyl)-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 15635121 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-(2-ethenyl-4,5-dimethoxyphenyl)-2-phenylpyrimidin-4-amine |
| SMILES | C=Cc1cc(OC)c(OC)cc1-c1cc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H19N3O2/c1-4-13-10-17(24-2)18(25-3)11-15(13)16-12-19(21)23-20(22-16)14-8-6-5-7-9-14/h4-12H,1H2,2-3H3,(H2,21,22,23) |
| InChIKey | CJLYOJOMQPHMHL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |