About trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane
trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane (PubChem CID 15635192) has the molecular formula C21H42OSi
and a molecular weight of 338.65 g/mol. Its IUPAC name is trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane |
| PubChem CID | 15635192 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[Si](C)(C)C |
| InChI | InChI=1S/C21H42OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2,3)4/h9-10,12-13H,5-8,11,14-21H2,1-4H3/b10-9-,13-12- |
| InChIKey | HETYFTDJRLLTQS-UTJQPWESSA-N |
| XLogP | 7.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane?
The IUPAC name of trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane (CID 15635192) is trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane.
What is the SMILES notation for trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane?
The canonical SMILES for trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane is CCCCC/C=C\C/C=C\CCCCCCCCO[Si](C)(C)C.
What is the InChIKey of trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane?
The InChIKey is HETYFTDJRLLTQS-UTJQPWESSA-N. The full InChI is InChI=1S/C21H42OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2,3)4/h9-10,12-13H,5-8,11,14-21H2,1-4H3/b10-9-,13-12-.
What are the key properties of trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane?
trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane has a molecular weight of 338.65 g/mol, XLogP of 7.65, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(9Z,12Z)-octadeca-9,12-dienoxy]silane is sourced from PubChem (CID 15635192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).