C14H30O2Si — CID 15635930
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-3-one (PubChem CID 15635930) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-3-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 15635930 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-3-one |
| SMILES | CCC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-10-11(15)12(13(2,3)4)16-17(8,9)14(5,6)7/h12H,10H2,1-9H3/t12-/m1/s1 |
| InChIKey | JLQZAJORGAJEBC-GFCCVEGCSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|