About (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate
(1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate (PubChem CID 15636667) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate |
| PubChem CID | 15636667 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate |
| SMILES | CCN1CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25NO3/c1-2-22-15-13-19(14-16-22)25-20(23)21(24,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19,24H,2,13-16H2,1H3 |
| InChIKey | ASNYPARLLRDJRH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The IUPAC name of (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate (CID 15636667) is (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate.
What is the SMILES notation for (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The canonical SMILES for (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate is CCN1CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
The InChIKey is ASNYPARLLRDJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-2-22-15-13-19(14-16-22)25-20(23)21(24,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19,24H,2,13-16H2,1H3.
What are the key properties of (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate?
(1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate has a molecular weight of 339.44 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) 2-hydroxy-2,2-diphenylacetate is sourced from PubChem (CID 15636667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).